C17H21N3O3S2 — CID 90500457
N-[2-[4-(thiophene-3-carbonyl)piperazin-1-yl]ethyl]benzenesulfonamide (PubChem CID 90500457) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is N-[2-[4-(thiophene-3-carbonyl)piperazin-1-yl]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[4-(thiophene-3-carbonyl)piperazin-1-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90500457 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[2-[4-(thiophene-3-carbonyl)piperazin-1-yl]ethyl]benzenesulfonamide |
| SMILES | O=C(c1ccsc1)N1CCN(CCNS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H21N3O3S2/c21-17(15-6-13-24-14-15)20-11-9-19(10-12-20)8-7-18-25(22,23)16-4-2-1-3-5-16/h1-6,13-14,18H,7-12H2 |
| InChIKey | RDEFHUOHRAJGSV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |