C19H25N3O3S2 — CID 90500443
1-(3-methylphenyl)-N-[2-[4-(thiophene-3-carbonyl)piperazin-1-yl]ethyl]methanesulfonamide (PubChem CID 90500443) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-(3-methylphenyl)-N-[2-[4-(thiophene-3-carbonyl)piperazin-1-yl]ethyl]methanesulfonamide.
| Compound Name | 1-(3-methylphenyl)-N-[2-[4-(thiophene-3-carbonyl)piperazin-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 90500443 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-(3-methylphenyl)-N-[2-[4-(thiophene-3-carbonyl)piperazin-1-yl]ethyl]methanesulfonamide |
| SMILES | Cc1cccc(CS(=O)(=O)NCCN2CCN(C(=O)c3ccsc3)CC2)c1 |
| InChI | InChI=1S/C19H25N3O3S2/c1-16-3-2-4-17(13-16)15-27(24,25)20-6-7-21-8-10-22(11-9-21)19(23)18-5-12-26-14-18/h2-5,12-14,20H,6-11,15H2,1H3 |
| InChIKey | BSOQUGHKPALEKA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |