C19H25N3O4S2 — CID 90500432
2-methoxy-5-methyl-N-[2-[4-(thiophene-3-carbonyl)piperazin-1-yl]ethyl]benzenesulfonamide (PubChem CID 90500432) has the molecular formula C19H25N3O4S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-methoxy-5-methyl-N-[2-[4-(thiophene-3-carbonyl)piperazin-1-yl]ethyl]benzenesulfonamide.
| Compound Name | 2-methoxy-5-methyl-N-[2-[4-(thiophene-3-carbonyl)piperazin-1-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90500432 |
| Molecular Formula | C19H25N3O4S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 2-methoxy-5-methyl-N-[2-[4-(thiophene-3-carbonyl)piperazin-1-yl]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)NCCN1CCN(C(=O)c2ccsc2)CC1 |
| InChI | InChI=1S/C19H25N3O4S2/c1-15-3-4-17(26-2)18(13-15)28(24,25)20-6-7-21-8-10-22(11-9-21)19(23)16-5-12-27-14-16/h3-5,12-14,20H,6-11H2,1-2H3 |
| InChIKey | BTVPKWZOOKIELV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |