C22H19NO — CID 174924527
4-(2,6-diphenyl-2H-pyran-4-yl)-1,2-dihydropyridine (PubChem CID 174924527) has the molecular formula C22H19NO and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-(2,6-diphenyl-2H-pyran-4-yl)-1,2-dihydropyridine.
| Compound Name | 4-(2,6-diphenyl-2H-pyran-4-yl)-1,2-dihydropyridine |
|---|---|
| PubChem CID | 174924527 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-(2,6-diphenyl-2H-pyran-4-yl)-1,2-dihydropyridine |
| SMILES | C1=CC(C2=CC(c3ccccc3)OC(c3ccccc3)=C2)=CCN1 |
| InChI | InChI=1S/C22H19NO/c1-3-7-18(8-4-1)21-15-20(17-11-13-23-14-12-17)16-22(24-21)19-9-5-2-6-10-19/h1-13,15-16,21,23H,14H2 |
| InChIKey | RFHBXSMAUFFAFY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |