C17H21NO4 — CID 174925415
oxolane-2,4-dione;N-(2-phenylbutan-2-yl)prop-2-enamide (PubChem CID 174925415) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is oxolane-2,4-dione;N-(2-phenylbutan-2-yl)prop-2-enamide.
| Compound Name | oxolane-2,4-dione;N-(2-phenylbutan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 174925415 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | oxolane-2,4-dione;N-(2-phenylbutan-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC(C)(CC)c1ccccc1.O=C1COC(=O)C1 |
| InChI | InChI=1S/C13H17NO.C4H4O3/c1-4-12(15)14-13(3,5-2)11-9-7-6-8-10-11;5-3-1-4(6)7-2-3/h4,6-10H,1,5H2,2-3H3,(H,14,15);1-2H2 |
| InChIKey | DJCDMFDUSQKZJT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|