C21H25N3O — CID 86899617
1-[4-(2-cyanopropan-2-yl)phenyl]-3-(2-phenylbutan-2-yl)urea (PubChem CID 86899617) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[4-(2-cyanopropan-2-yl)phenyl]-3-(2-phenylbutan-2-yl)urea.
| Compound Name | 1-[4-(2-cyanopropan-2-yl)phenyl]-3-(2-phenylbutan-2-yl)urea |
|---|---|
| PubChem CID | 86899617 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-[4-(2-cyanopropan-2-yl)phenyl]-3-(2-phenylbutan-2-yl)urea |
| SMILES | CCC(C)(NC(=O)Nc1ccc(C(C)(C)C#N)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O/c1-5-21(4,17-9-7-6-8-10-17)24-19(25)23-18-13-11-16(12-14-18)20(2,3)15-22/h6-14H,5H2,1-4H3,(H2,23,24,25) |
| InChIKey | OHNHKMAYYNIIGT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |