C17H20N2O2 — CID 95318710
1-[(2S)-1-hydroxy-2-phenylbutan-2-yl]-3-phenylurea (PubChem CID 95318710) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-[(2S)-1-hydroxy-2-phenylbutan-2-yl]-3-phenylurea.
| Compound Name | 1-[(2S)-1-hydroxy-2-phenylbutan-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 95318710 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-[(2S)-1-hydroxy-2-phenylbutan-2-yl]-3-phenylurea |
| SMILES | CC[C@](CO)(NC(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O2/c1-2-17(13-20,14-9-5-3-6-10-14)19-16(21)18-15-11-7-4-8-12-15/h3-12,20H,2,13H2,1H3,(H2,18,19,21)/t17-/m1/s1 |
| InChIKey | AIMYNEMZXRYKEW-QGZVFWFLSA-N |
| XLogP | 3.11 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |