C16H20F3N3 — CID 174925522
1-propan-2-yl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]-2H-pyrimidin-4-amine (PubChem CID 174925522) has the molecular formula C16H20F3N3 and a molecular weight of 311.35 g/mol. Its IUPAC name is 1-propan-2-yl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]-2H-pyrimidin-4-amine.
| Compound Name | 1-propan-2-yl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]-2H-pyrimidin-4-amine |
|---|---|
| PubChem CID | 174925522 |
| Molecular Formula | C16H20F3N3 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 1-propan-2-yl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]-2H-pyrimidin-4-amine |
| SMILES | CC(NC1=NCN(C(C)C)C=C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F3N3/c1-11(2)22-8-7-15(20-10-22)21-12(3)13-5-4-6-14(9-13)16(17,18)19/h4-9,11-12H,10H2,1-3H3,(H,20,21) |
| InChIKey | JNZNHGGTFYUJST-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |