About ethyl formate;4-methyl-3-nitropyridine
ethyl formate;4-methyl-3-nitropyridine (PubChem CID 174926168) has the molecular formula C9H12N2O4
and a molecular weight of 212.21 g/mol. Its IUPAC name is ethyl formate;4-methyl-3-nitropyridine.
Molecular Properties
| Compound Name | ethyl formate;4-methyl-3-nitropyridine |
| PubChem CID | 174926168 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | ethyl formate;4-methyl-3-nitropyridine |
| SMILES | CCOC=O.Cc1ccncc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N2O2.C3H6O2/c1-5-2-3-7-4-6(5)8(9)10;1-2-5-3-4/h2-4H,1H3;3H,2H2,1H3 |
| InChIKey | SCVWQGJONYAYBA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;4-methyl-3-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;4-methyl-3-nitropyridine?
The IUPAC name of ethyl formate;4-methyl-3-nitropyridine (CID 174926168) is ethyl formate;4-methyl-3-nitropyridine.
What is the SMILES notation for ethyl formate;4-methyl-3-nitropyridine?
The canonical SMILES for ethyl formate;4-methyl-3-nitropyridine is CCOC=O.Cc1ccncc1[N+](=O)[O-].
What is the InChIKey of ethyl formate;4-methyl-3-nitropyridine?
The InChIKey is SCVWQGJONYAYBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.C3H6O2/c1-5-2-3-7-4-6(5)8(9)10;1-2-5-3-4/h2-4H,1H3;3H,2H2,1H3.
What are the key properties of ethyl formate;4-methyl-3-nitropyridine?
ethyl formate;4-methyl-3-nitropyridine has a molecular weight of 212.21 g/mol, XLogP of 1.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;4-methyl-3-nitropyridine is sourced from PubChem (CID 174926168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).