C10H14ClNO4S — CID 174926588
6-cyclopentyloxypyridine-3-sulfonic acid;hydrochloride (PubChem CID 174926588) has the molecular formula C10H14ClNO4S and a molecular weight of 279.74 g/mol. Its IUPAC name is 6-cyclopentyloxypyridine-3-sulfonic acid;hydrochloride.
| Compound Name | 6-cyclopentyloxypyridine-3-sulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 174926588 |
| Molecular Formula | C10H14ClNO4S |
| Molecular Weight | 279.74 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 6-cyclopentyloxypyridine-3-sulfonic acid;hydrochloride |
| SMILES | Cl.O=S(=O)(O)c1ccc(OC2CCCC2)nc1 |
| InChI | InChI=1S/C10H13NO4S.ClH/c12-16(13,14)9-5-6-10(11-7-9)15-8-3-1-2-4-8;/h5-8H,1-4H2,(H,12,13,14);1H |
| InChIKey | VHBFOQBAKUKQDQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.74 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|