C22H34N2O6S — CID 67449879
tert-butyl 4-[4-[(5-methylsulfonyl-2-pyridinyl)oxy]cyclohexyl]oxypiperidine-1-carboxylate (PubChem CID 67449879) has the molecular formula C22H34N2O6S and a molecular weight of 454.59 g/mol. Its IUPAC name is tert-butyl 4-[4-[(5-methylsulfonyl-2-pyridinyl)oxy]cyclohexyl]oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(5-methylsulfonyl-2-pyridinyl)oxy]cyclohexyl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 67449879 |
| Molecular Formula | C22H34N2O6S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | tert-butyl 4-[4-[(5-methylsulfonyl-2-pyridinyl)oxy]cyclohexyl]oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OC2CCC(Oc3ccc(S(C)(=O)=O)cn3)CC2)CC1 |
| InChI | InChI=1S/C22H34N2O6S/c1-22(2,3)30-21(25)24-13-11-18(12-14-24)28-16-5-7-17(8-6-16)29-20-10-9-19(15-23-20)31(4,26)27/h9-10,15-18H,5-8,11-14H2,1-4H3 |
| InChIKey | LBVDJXAFBKDTID-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |