About sodium;hydride;1H-imidazol-2-yl sulfite
sodium;hydride;1H-imidazol-2-yl sulfite (PubChem CID 174926743) has the molecular formula C3H4N2NaO3S-
and a molecular weight of 171.13 g/mol. Its IUPAC name is sodium;hydride;1H-imidazol-2-yl sulfite.
Molecular Properties
| Compound Name | sodium;hydride;1H-imidazol-2-yl sulfite |
| PubChem CID | 174926743 |
| Molecular Formula | C3H4N2NaO3S- |
| Molecular Weight | 171.13 g/mol |
| Exact Mass | 170.98 |
| IUPAC Name | sodium;hydride;1H-imidazol-2-yl sulfite |
| SMILES | O=S([O-])Oc1ncc[nH]1.[H-].[Na+] |
| InChI | InChI=1S/C3H4N2O3S.Na.H/c6-9(7)8-3-4-1-2-5-3;;/h1-2H,(H,4,5)(H,6,7);;/q;+1;-1/p-1 |
| InChIKey | ZSDHPKCMINVXAI-UHFFFAOYSA-M |
| XLogP | -3.30 |
| TPSA | 78.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.13 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;1H-imidazol-2-yl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;1H-imidazol-2-yl sulfite?
The IUPAC name of sodium;hydride;1H-imidazol-2-yl sulfite (CID 174926743) is sodium;hydride;1H-imidazol-2-yl sulfite.
What is the SMILES notation for sodium;hydride;1H-imidazol-2-yl sulfite?
The canonical SMILES for sodium;hydride;1H-imidazol-2-yl sulfite is O=S([O-])Oc1ncc[nH]1.[H-].[Na+].
What is the InChIKey of sodium;hydride;1H-imidazol-2-yl sulfite?
The InChIKey is ZSDHPKCMINVXAI-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H4N2O3S.Na.H/c6-9(7)8-3-4-1-2-5-3;;/h1-2H,(H,4,5)(H,6,7);;/q;+1;-1/p-1.
What are the key properties of sodium;hydride;1H-imidazol-2-yl sulfite?
sodium;hydride;1H-imidazol-2-yl sulfite has a molecular weight of 171.13 g/mol, XLogP of -3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;1H-imidazol-2-yl sulfite is sourced from PubChem (CID 174926743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).