C6HCl11O2 — CID 174927745
2,3,4,4,4-pentachloro-2,3-bis(trichloromethyl)butanoic acid (PubChem CID 174927745) has the molecular formula C6HCl11O2 and a molecular weight of 495.06 g/mol. Its IUPAC name is 2,3,4,4,4-pentachloro-2,3-bis(trichloromethyl)butanoic acid.
| Compound Name | 2,3,4,4,4-pentachloro-2,3-bis(trichloromethyl)butanoic acid |
|---|---|
| PubChem CID | 174927745 |
| Molecular Formula | C6HCl11O2 |
| Molecular Weight | 495.06 g/mol |
| Exact Mass | 489.66 |
| IUPAC Name | 2,3,4,4,4-pentachloro-2,3-bis(trichloromethyl)butanoic acid |
| SMILES | O=C(O)C(Cl)(C(Cl)(Cl)Cl)C(Cl)(C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6HCl11O2/c7-2(1(18)19,4(9,10)11)3(8,5(12,13)14)6(15,16)17/h(H,18,19) |
| InChIKey | CTJUSTAKBZDZMK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.06 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|