C18H29N3 — CID 174930356
4-but-3-en-2-yl-1,5-dicyclohexyltriazole (PubChem CID 174930356) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 4-but-3-en-2-yl-1,5-dicyclohexyltriazole.
| Compound Name | 4-but-3-en-2-yl-1,5-dicyclohexyltriazole |
|---|---|
| PubChem CID | 174930356 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 4-but-3-en-2-yl-1,5-dicyclohexyltriazole |
| SMILES | C=CC(C)c1nnn(C2CCCCC2)c1C1CCCCC1 |
| InChI | InChI=1S/C18H29N3/c1-3-14(2)17-18(15-10-6-4-7-11-15)21(20-19-17)16-12-8-5-9-13-16/h3,14-16H,1,4-13H2,2H3 |
| InChIKey | UHYPBWLQLKVGEL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|