C20H18Cl2N2O2 — CID 174930679
3,5-dichloroaniline;2-methyl-4-phenoxybenzamide (PubChem CID 174930679) has the molecular formula C20H18Cl2N2O2 and a molecular weight of 389.28 g/mol. Its IUPAC name is 3,5-dichloroaniline;2-methyl-4-phenoxybenzamide.
| Compound Name | 3,5-dichloroaniline;2-methyl-4-phenoxybenzamide |
|---|---|
| PubChem CID | 174930679 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 3,5-dichloroaniline;2-methyl-4-phenoxybenzamide |
| SMILES | Cc1cc(Oc2ccccc2)ccc1C(N)=O.Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H13NO2.C6H5Cl2N/c1-10-9-12(7-8-13(10)14(15)16)17-11-5-3-2-4-6-11;7-4-1-5(8)3-6(9)2-4/h2-9H,1H3,(H2,15,16);1-3H,9H2 |
| InChIKey | LEARORULLJWVAM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|