C25H16Cl2O3 — CID 69006998
(2,5-dichloro-3-phenoxyphenyl)-(4-phenoxyphenyl)methanone (PubChem CID 69006998) has the molecular formula C25H16Cl2O3 and a molecular weight of 435.31 g/mol. Its IUPAC name is (2,5-dichloro-3-phenoxyphenyl)-(4-phenoxyphenyl)methanone.
| Compound Name | (2,5-dichloro-3-phenoxyphenyl)-(4-phenoxyphenyl)methanone |
|---|---|
| PubChem CID | 69006998 |
| Molecular Formula | C25H16Cl2O3 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | (2,5-dichloro-3-phenoxyphenyl)-(4-phenoxyphenyl)methanone |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1)c1cc(Cl)cc(Oc2ccccc2)c1Cl |
| InChI | InChI=1S/C25H16Cl2O3/c26-18-15-22(24(27)23(16-18)30-20-9-5-2-6-10-20)25(28)17-11-13-21(14-12-17)29-19-7-3-1-4-8-19/h1-16H |
| InChIKey | WMNAOLYAVFVOLY-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |