C25H16Cl2O2 — CID 139963055
[2-(2,5-dichlorophenyl)phenyl]-(4-phenoxyphenyl)methanone (PubChem CID 139963055) has the molecular formula C25H16Cl2O2 and a molecular weight of 419.31 g/mol. Its IUPAC name is [2-(2,5-dichlorophenyl)phenyl]-(4-phenoxyphenyl)methanone.
| Compound Name | [2-(2,5-dichlorophenyl)phenyl]-(4-phenoxyphenyl)methanone |
|---|---|
| PubChem CID | 139963055 |
| Molecular Formula | C25H16Cl2O2 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | [2-(2,5-dichlorophenyl)phenyl]-(4-phenoxyphenyl)methanone |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1)c1ccccc1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C25H16Cl2O2/c26-18-12-15-24(27)23(16-18)21-8-4-5-9-22(21)25(28)17-10-13-20(14-11-17)29-19-6-2-1-3-7-19/h1-16H |
| InChIKey | UFWPPWMFXKZPPK-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |