C30H20O6 — CID 58626356
(4-phenoxyphenyl)-[2,3,4-trihydroxy-5-(naphthalene-2-carbonyl)phenyl]methanone (PubChem CID 58626356) has the molecular formula C30H20O6 and a molecular weight of 476.48 g/mol. Its IUPAC name is (4-phenoxyphenyl)-[2,3,4-trihydroxy-5-(naphthalene-2-carbonyl)phenyl]methanone.
| Compound Name | (4-phenoxyphenyl)-[2,3,4-trihydroxy-5-(naphthalene-2-carbonyl)phenyl]methanone |
|---|---|
| PubChem CID | 58626356 |
| Molecular Formula | C30H20O6 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (4-phenoxyphenyl)-[2,3,4-trihydroxy-5-(naphthalene-2-carbonyl)phenyl]methanone |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1)c1cc(C(=O)c2ccc3ccccc3c2)c(O)c(O)c1O |
| InChI | InChI=1S/C30H20O6/c31-26(19-12-14-23(15-13-19)36-22-8-2-1-3-9-22)24-17-25(29(34)30(35)28(24)33)27(32)21-11-10-18-6-4-5-7-20(18)16-21/h1-17,33-35H |
| InChIKey | PAYVUXNMYLDDFO-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|