C18H23F3N2O3 — CID 174931684
[2-oxo-2-[2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]ethyl] N-tert-butylcarbamate (PubChem CID 174931684) has the molecular formula C18H23F3N2O3 and a molecular weight of 372.39 g/mol. Its IUPAC name is [2-oxo-2-[2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]ethyl] N-tert-butylcarbamate.
| Compound Name | [2-oxo-2-[2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]ethyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174931684 |
| Molecular Formula | C18H23F3N2O3 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [2-oxo-2-[2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]ethyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCC(=O)N1CCCC1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H23F3N2O3/c1-17(2,3)22-16(25)26-11-15(24)23-10-6-9-14(23)12-7-4-5-8-13(12)18(19,20)21/h4-5,7-8,14H,6,9-11H2,1-3H3,(H,22,25) |
| InChIKey | MXOQNTDWRRPANX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |