C16H18F3NO — CID 95290891
cyclobutyl-[(2S)-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methanone (PubChem CID 95290891) has the molecular formula C16H18F3NO and a molecular weight of 297.32 g/mol. Its IUPAC name is cyclobutyl-[(2S)-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methanone.
| Compound Name | cyclobutyl-[(2S)-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95290891 |
| Molecular Formula | C16H18F3NO |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | cyclobutyl-[(2S)-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CCC1)N1CCC[C@H]1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H18F3NO/c17-16(18,19)13-8-2-1-7-12(13)14-9-4-10-20(14)15(21)11-5-3-6-11/h1-2,7-8,11,14H,3-6,9-10H2/t14-/m0/s1 |
| InChIKey | BTZUCYQFGFJTFU-AWEZNQCLSA-N |
| XLogP | 4.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |