C20H21F3N2S — CID 45489222
N-(3-ethylphenyl)-2-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carbothioamide (PubChem CID 45489222) has the molecular formula C20H21F3N2S and a molecular weight of 378.46 g/mol. Its IUPAC name is N-(3-ethylphenyl)-2-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carbothioamide.
| Compound Name | N-(3-ethylphenyl)-2-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 45489222 |
| Molecular Formula | C20H21F3N2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-(3-ethylphenyl)-2-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carbothioamide |
| SMILES | CCc1cccc(NC(=S)N2CCCC2c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21F3N2S/c1-2-14-7-5-8-15(13-14)24-19(26)25-12-6-11-18(25)16-9-3-4-10-17(16)20(21,22)23/h3-5,7-10,13,18H,2,6,11-12H2,1H3,(H,24,26) |
| InChIKey | GNTWNMCTVSHXSR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|