C17H18F3N3S — CID 97010091
(2R)-2-(1-methylpyrrol-2-yl)-N-[3-(trifluoromethyl)phenyl]pyrrolidine-1-carbothioamide (PubChem CID 97010091) has the molecular formula C17H18F3N3S and a molecular weight of 353.41 g/mol. Its IUPAC name is (2R)-2-(1-methylpyrrol-2-yl)-N-[3-(trifluoromethyl)phenyl]pyrrolidine-1-carbothioamide.
| Compound Name | (2R)-2-(1-methylpyrrol-2-yl)-N-[3-(trifluoromethyl)phenyl]pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 97010091 |
| Molecular Formula | C17H18F3N3S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2R)-2-(1-methylpyrrol-2-yl)-N-[3-(trifluoromethyl)phenyl]pyrrolidine-1-carbothioamide |
| SMILES | Cn1cccc1[C@H]1CCCN1C(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F3N3S/c1-22-9-3-7-14(22)15-8-4-10-23(15)16(24)21-13-6-2-5-12(11-13)17(18,19)20/h2-3,5-7,9,11,15H,4,8,10H2,1H3,(H,21,24)/t15-/m1/s1 |
| InChIKey | RTVUFCXKEPLCFK-OAHLLOKOSA-N |
| XLogP | 4.58 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|