C21H27N3O2S — CID 71900893
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-2-(1-methylpyrrol-2-yl)azepane-1-carbothioamide (PubChem CID 71900893) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-2-(1-methylpyrrol-2-yl)azepane-1-carbothioamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-2-(1-methylpyrrol-2-yl)azepane-1-carbothioamide |
|---|---|
| PubChem CID | 71900893 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-2-(1-methylpyrrol-2-yl)azepane-1-carbothioamide |
| SMILES | CC1CCC(c2cccn2C)N(C(=S)Nc2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C21H27N3O2S/c1-15-5-7-18(17-4-3-10-23(17)2)24(11-9-15)21(27)22-16-6-8-19-20(14-16)26-13-12-25-19/h3-4,6,8,10,14-15,18H,5,7,9,11-13H2,1-2H3,(H,22,27) |
| InChIKey | MCJBFEUPYVYIJV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|