About oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene
oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene (PubChem CID 174931923) has the molecular formula C18H18O3Zn
and a molecular weight of 347.73 g/mol. Its IUPAC name is oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene.
Molecular Properties
| Compound Name | oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene |
| PubChem CID | 174931923 |
| Molecular Formula | C18H18O3Zn |
| Molecular Weight | 347.73 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene |
| SMILES | C=CCc1ccc(OOc2ccc(CC=C)cc2)cc1.O=[Zn] |
| InChI | InChI=1S/C18H18O2.O.Zn/c1-3-5-15-7-11-17(12-8-15)19-20-18-13-9-16(6-4-2)10-14-18;;/h3-4,7-14H,1-2,5-6H2;; |
| InChIKey | LKSKQAMHXHPJFD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.73 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene?
The IUPAC name of oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene (CID 174931923) is oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene.
What is the SMILES notation for oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene?
The canonical SMILES for oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene is C=CCc1ccc(OOc2ccc(CC=C)cc2)cc1.O=[Zn].
What is the InChIKey of oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene?
The InChIKey is LKSKQAMHXHPJFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O2.O.Zn/c1-3-5-15-7-11-17(12-8-15)19-20-18-13-9-16(6-4-2)10-14-18;;/h3-4,7-14H,1-2,5-6H2;;.
What are the key properties of oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene?
oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene has a molecular weight of 347.73 g/mol, XLogP of 4.40, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxozinc;1-prop-2-enyl-4-(4-prop-2-enylphenyl)peroxybenzene is sourced from PubChem (CID 174931923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).