About (4-prop-2-enylphenyl) 2-hydroperoxyacetate
(4-prop-2-enylphenyl) 2-hydroperoxyacetate (PubChem CID 88806265) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is (4-prop-2-enylphenyl) 2-hydroperoxyacetate.
Molecular Properties
| Compound Name | (4-prop-2-enylphenyl) 2-hydroperoxyacetate |
| PubChem CID | 88806265 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (4-prop-2-enylphenyl) 2-hydroperoxyacetate |
| SMILES | C=CCc1ccc(OC(=O)COO)cc1 |
| InChI | InChI=1S/C11H12O4/c1-2-3-9-4-6-10(7-5-9)15-11(12)8-14-13/h2,4-7,13H,1,3,8H2 |
| InChIKey | QGIZKMZGPWVNQV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-prop-2-enylphenyl) 2-hydroperoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-prop-2-enylphenyl) 2-hydroperoxyacetate?
The IUPAC name of (4-prop-2-enylphenyl) 2-hydroperoxyacetate (CID 88806265) is (4-prop-2-enylphenyl) 2-hydroperoxyacetate.
What is the SMILES notation for (4-prop-2-enylphenyl) 2-hydroperoxyacetate?
The canonical SMILES for (4-prop-2-enylphenyl) 2-hydroperoxyacetate is C=CCc1ccc(OC(=O)COO)cc1.
What is the InChIKey of (4-prop-2-enylphenyl) 2-hydroperoxyacetate?
The InChIKey is QGIZKMZGPWVNQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c1-2-3-9-4-6-10(7-5-9)15-11(12)8-14-13/h2,4-7,13H,1,3,8H2.
What are the key properties of (4-prop-2-enylphenyl) 2-hydroperoxyacetate?
(4-prop-2-enylphenyl) 2-hydroperoxyacetate has a molecular weight of 208.21 g/mol, XLogP of 1.81, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-prop-2-enylphenyl) 2-hydroperoxyacetate is sourced from PubChem (CID 88806265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).