About bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline
bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline (PubChem CID 174932520) has the molecular formula C16H18BrNO
and a molecular weight of 320.23 g/mol. Its IUPAC name is bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline |
| PubChem CID | 174932520 |
| Molecular Formula | C16H18BrNO |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline |
| SMILES | BrCOc1ccc2cccnc2c1.C1CC2CC2C1 |
| InChI | InChI=1S/C10H8BrNO.C6H10/c11-7-13-9-4-3-8-2-1-5-12-10(8)6-9;1-2-5-4-6(5)3-1/h1-6H,7H2;5-6H,1-4H2 |
| InChIKey | DDBAVBREYYHWKB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline?
The IUPAC name of bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline (CID 174932520) is bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline.
What is the SMILES notation for bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline?
The canonical SMILES for bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline is BrCOc1ccc2cccnc2c1.C1CC2CC2C1.
What is the InChIKey of bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline?
The InChIKey is DDBAVBREYYHWKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrNO.C6H10/c11-7-13-9-4-3-8-2-1-5-12-10(8)6-9;1-2-5-4-6(5)3-1/h1-6H,7H2;5-6H,1-4H2.
What are the key properties of bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline?
bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline has a molecular weight of 320.23 g/mol, XLogP of 4.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexane;7-(bromomethoxy)quinoline is sourced from PubChem (CID 174932520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).