About 4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol
4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol (PubChem CID 174933334) has the molecular formula C11H9AgF3O2S2
and a molecular weight of 402.19 g/mol. Its IUPAC name is 4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol.
Molecular Properties
| Compound Name | 4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol |
| PubChem CID | 174933334 |
| Molecular Formula | C11H9AgF3O2S2 |
| Molecular Weight | 402.19 g/mol |
| Exact Mass | 400.90 |
| IUPAC Name | 4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol |
| SMILES | Cc1c(S)c(=O)oc2ccccc12.FC(F)(F)S.[Ag] |
| InChI | InChI=1S/C10H8O2S.CHF3S.Ag/c1-6-7-4-2-3-5-8(7)12-10(11)9(6)13;2-1(3,4)5;/h2-5,13H,1H3;5H; |
| InChIKey | ZFYWIZHDJNNSNI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 30.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.19 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol?
The IUPAC name of 4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol (CID 174933334) is 4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol.
What is the SMILES notation for 4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol?
The canonical SMILES for 4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol is Cc1c(S)c(=O)oc2ccccc12.FC(F)(F)S.[Ag].
What is the InChIKey of 4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol?
The InChIKey is ZFYWIZHDJNNSNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2S.CHF3S.Ag/c1-6-7-4-2-3-5-8(7)12-10(11)9(6)13;2-1(3,4)5;/h2-5,13H,1H3;5H;.
What are the key properties of 4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol?
4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol has a molecular weight of 402.19 g/mol, XLogP of 3.82, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-sulfanylchromen-2-one;silver;trifluoromethanethiol is sourced from PubChem (CID 174933334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).