About [chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride
[chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride (PubChem CID 174937204) has the molecular formula C7H9Cl4NO2P2
and a molecular weight of 342.91 g/mol. Its IUPAC name is [chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride.
Molecular Properties
| Compound Name | [chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride |
| PubChem CID | 174937204 |
| Molecular Formula | C7H9Cl4NO2P2 |
| Molecular Weight | 342.91 g/mol |
| Exact Mass | 340.89 |
| IUPAC Name | [chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride |
| SMILES | NCP(=O)(Cl)c1ccccc1.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H9ClNOP.Cl3OP/c8-11(10,6-9)7-4-2-1-3-5-7;1-5(2,3)4/h1-5H,6,9H2; |
| InChIKey | KZMMMTKIBMRTJX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.91 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride?
The IUPAC name of [chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride (CID 174937204) is [chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride.
What is the SMILES notation for [chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride?
The canonical SMILES for [chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride is NCP(=O)(Cl)c1ccccc1.O=P(Cl)(Cl)Cl.
What is the InChIKey of [chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride?
The InChIKey is KZMMMTKIBMRTJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClNOP.Cl3OP/c8-11(10,6-9)7-4-2-1-3-5-7;1-5(2,3)4/h1-5H,6,9H2;.
What are the key properties of [chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride?
[chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride has a molecular weight of 342.91 g/mol, XLogP of 4.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [chloro(phenyl)phosphoryl]methanamine;phosphoryl trichloride is sourced from PubChem (CID 174937204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).