C41H51N7O6 — CID 174937266
4-amino-1-[6-amino-2-[[2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-phenylpropanoyl]amino]-5-phenylpent-4-ynoyl]amino]hexanoyl]piperidine-4-carboxylic acid (PubChem CID 174937266) has the molecular formula C41H51N7O6 and a molecular weight of 737.90 g/mol. Its IUPAC name is 4-amino-1-[6-amino-2-[[2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-phenylpropanoyl]amino]-5-phenylpent-4-ynoyl]amino]hexanoyl]piperidine-4-carboxylic acid.
| Compound Name | 4-amino-1-[6-amino-2-[[2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-phenylpropanoyl]amino]-5-phenylpent-4-ynoyl]amino]hexanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 174937266 |
| Molecular Formula | C41H51N7O6 |
| Molecular Weight | 737.90 g/mol |
| Exact Mass | 737.39 |
| IUPAC Name | 4-amino-1-[6-amino-2-[[2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-phenylpropanoyl]amino]-5-phenylpent-4-ynoyl]amino]hexanoyl]piperidine-4-carboxylic acid |
| SMILES | NCCCCC(NC(=O)C(CC#Cc1ccccc1)NC(=O)C(Cc1ccccc1)NC(=O)C(N)Cc1ccccc1)C(=O)N1CCC(N)(C(=O)O)CC1 |
| InChI | InChI=1S/C41H51N7O6/c42-24-11-10-20-34(39(52)48-25-22-41(44,23-26-48)40(53)54)46-37(50)33(21-12-19-29-13-4-1-5-14-29)45-38(51)35(28-31-17-8-3-9-18-31)47-36(49)32(43)27-30-15-6-2-7-16-30/h1-9,13-18,32-35H,10-11,20-28,42-44H2,(H,45,51)(H,46,50)(H,47,49)(H,53,54) |
| InChIKey | IENMBVFOBNLONX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 222.97 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.90 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|