C32H42N6O5 — CID 175251676
4-amino-1-[6-amino-2-[[2-[(2-amino-3-phenylpropanoyl)amino]-5-phenylpent-4-ynoyl]amino]hexanoyl]piperidine-4-carboxylic acid (PubChem CID 175251676) has the molecular formula C32H42N6O5 and a molecular weight of 590.73 g/mol. Its IUPAC name is 4-amino-1-[6-amino-2-[[2-[(2-amino-3-phenylpropanoyl)amino]-5-phenylpent-4-ynoyl]amino]hexanoyl]piperidine-4-carboxylic acid.
| Compound Name | 4-amino-1-[6-amino-2-[[2-[(2-amino-3-phenylpropanoyl)amino]-5-phenylpent-4-ynoyl]amino]hexanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 175251676 |
| Molecular Formula | C32H42N6O5 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | 4-amino-1-[6-amino-2-[[2-[(2-amino-3-phenylpropanoyl)amino]-5-phenylpent-4-ynoyl]amino]hexanoyl]piperidine-4-carboxylic acid |
| SMILES | NCCCCC(NC(=O)C(CC#Cc1ccccc1)NC(=O)C(N)Cc1ccccc1)C(=O)N1CCC(N)(C(=O)O)CC1 |
| InChI | InChI=1S/C32H42N6O5/c33-19-8-7-15-27(30(41)38-20-17-32(35,18-21-38)31(42)43)37-29(40)26(16-9-14-23-10-3-1-4-11-23)36-28(39)25(34)22-24-12-5-2-6-13-24/h1-6,10-13,25-27H,7-8,15-22,33-35H2,(H,36,39)(H,37,40)(H,42,43) |
| InChIKey | KCTRWKCMPWUUKN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 193.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|