C14H20Cl3NO2S — CID 174938121
N-ethyl-2-methyl-N-phenylsulfanylpropan-2-amine;2,2,2-trichloroacetic acid (PubChem CID 174938121) has the molecular formula C14H20Cl3NO2S and a molecular weight of 372.75 g/mol. Its IUPAC name is N-ethyl-2-methyl-N-phenylsulfanylpropan-2-amine;2,2,2-trichloroacetic acid.
| Compound Name | N-ethyl-2-methyl-N-phenylsulfanylpropan-2-amine;2,2,2-trichloroacetic acid |
|---|---|
| PubChem CID | 174938121 |
| Molecular Formula | C14H20Cl3NO2S |
| Molecular Weight | 372.75 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-ethyl-2-methyl-N-phenylsulfanylpropan-2-amine;2,2,2-trichloroacetic acid |
| SMILES | CCN(Sc1ccccc1)C(C)(C)C.O=C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H19NS.C2HCl3O2/c1-5-13(12(2,3)4)14-11-9-7-6-8-10-11;3-2(4,5)1(6)7/h6-10H,5H2,1-4H3;(H,6,7) |
| InChIKey | HTUHEWTYCAUDOZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.75 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|