C18H20O3 — CID 174938822
3,3-dimethoxy-2-(2-methylphenyl)-3-phenylpropanal (PubChem CID 174938822) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3,3-dimethoxy-2-(2-methylphenyl)-3-phenylpropanal.
| Compound Name | 3,3-dimethoxy-2-(2-methylphenyl)-3-phenylpropanal |
|---|---|
| PubChem CID | 174938822 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3,3-dimethoxy-2-(2-methylphenyl)-3-phenylpropanal |
| SMILES | COC(OC)(c1ccccc1)C(C=O)c1ccccc1C |
| InChI | InChI=1S/C18H20O3/c1-14-9-7-8-12-16(14)17(13-19)18(20-2,21-3)15-10-5-4-6-11-15/h4-13,17H,1-3H3 |
| InChIKey | JQXKQDZHIJTMRM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|