C17H18N2O2S — CID 174939258
2,4,5-trimethyl-1-(4-methylphenyl)sulfonylbenzimidazole (PubChem CID 174939258) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 2,4,5-trimethyl-1-(4-methylphenyl)sulfonylbenzimidazole.
| Compound Name | 2,4,5-trimethyl-1-(4-methylphenyl)sulfonylbenzimidazole |
|---|---|
| PubChem CID | 174939258 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2,4,5-trimethyl-1-(4-methylphenyl)sulfonylbenzimidazole |
| SMILES | Cc1ccc(S(=O)(=O)n2c(C)nc3c(C)c(C)ccc32)cc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-11-5-8-15(9-6-11)22(20,21)19-14(4)18-17-13(3)12(2)7-10-16(17)19/h5-10H,1-4H3 |
| InChIKey | PWOZYPOUOPWHJJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |