C21H19NO2S — CID 139886765
2,5-dimethyl-1-[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonylpyrrole (PubChem CID 139886765) has the molecular formula C21H19NO2S and a molecular weight of 349.46 g/mol. Its IUPAC name is 2,5-dimethyl-1-[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonylpyrrole.
| Compound Name | 2,5-dimethyl-1-[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonylpyrrole |
|---|---|
| PubChem CID | 139886765 |
| Molecular Formula | C21H19NO2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2,5-dimethyl-1-[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonylpyrrole |
| SMILES | Cc1ccc(C#Cc2ccc(S(=O)(=O)n3c(C)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C21H19NO2S/c1-16-4-8-19(9-5-16)10-11-20-12-14-21(15-13-20)25(23,24)22-17(2)6-7-18(22)3/h4-9,12-15H,1-3H3 |
| InChIKey | PDTGMVAUJRHDPT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|