C28H26N2O4S6 — CID 139230888
2-[4,6-dimethyl-5-(4-methylphenyl)sulfonyl-[1,3]dithiolo[4,5-c]pyrrol-2-ylidene]-4,6-dimethyl-5-(4-methylphenyl)sulfonyl-[1,3]dithiolo[4,5-c]pyrrole (PubChem CID 139230888) has the molecular formula C28H26N2O4S6 and a molecular weight of 646.93 g/mol. Its IUPAC name is 2-[4,6-dimethyl-5-(4-methylphenyl)sulfonyl-[1,3]dithiolo[4,5-c]pyrrol-2-ylidene]-4,6-dimethyl-5-(4-methylphenyl)sulfonyl-[1,3]dithiolo[4,5-c]pyrrole.
| Compound Name | 2-[4,6-dimethyl-5-(4-methylphenyl)sulfonyl-[1,3]dithiolo[4,5-c]pyrrol-2-ylidene]-4,6-dimethyl-5-(4-methylphenyl)sulfonyl-[1,3]dithiolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 139230888 |
| Molecular Formula | C28H26N2O4S6 |
| Molecular Weight | 646.93 g/mol |
| Exact Mass | 646.02 |
| IUPAC Name | 2-[4,6-dimethyl-5-(4-methylphenyl)sulfonyl-[1,3]dithiolo[4,5-c]pyrrol-2-ylidene]-4,6-dimethyl-5-(4-methylphenyl)sulfonyl-[1,3]dithiolo[4,5-c]pyrrole |
| SMILES | Cc1ccc(S(=O)(=O)n2c(C)c3c(c2C)SC(=C2Sc4c(c(C)n(S(=O)(=O)c5ccc(C)cc5)c4C)S2)S3)cc1 |
| InChI | InChI=1S/C28H26N2O4S6/c1-15-7-11-21(12-8-15)39(31,32)29-17(3)23-24(18(29)4)36-27(35-23)28-37-25-19(5)30(20(6)26(25)38-28)40(33,34)22-13-9-16(2)10-14-22/h7-14H,1-6H3 |
| InChIKey | XQOPPTMXQNVGLM-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.93 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |