C24H18N2O4S4 — CID 164674624
7,14-bis-(4-methylphenyl)sulfonyl-3,10-dithia-7,14-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene (PubChem CID 164674624) has the molecular formula C24H18N2O4S4 and a molecular weight of 526.69 g/mol. Its IUPAC name is 7,14-bis-(4-methylphenyl)sulfonyl-3,10-dithia-7,14-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene.
| Compound Name | 7,14-bis-(4-methylphenyl)sulfonyl-3,10-dithia-7,14-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene |
|---|---|
| PubChem CID | 164674624 |
| Molecular Formula | C24H18N2O4S4 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.01 |
| IUPAC Name | 7,14-bis-(4-methylphenyl)sulfonyl-3,10-dithia-7,14-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene |
| SMILES | Cc1ccc(S(=O)(=O)n2c3ccsc3c3c2c2sccc2n3S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H18N2O4S4/c1-15-3-7-17(8-4-15)33(27,28)25-19-11-13-31-23(19)22-21(25)24-20(12-14-32-24)26(22)34(29,30)18-9-5-16(2)6-10-18/h3-14H,1-2H3 |
| InChIKey | LAVTWUWCBKFWPW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |