About benzene;(2-carbamoylphenyl)methyl formate
benzene;(2-carbamoylphenyl)methyl formate (PubChem CID 174940813) has the molecular formula C15H15NO3
and a molecular weight of 257.29 g/mol. Its IUPAC name is benzene;(2-carbamoylphenyl)methyl formate.
Molecular Properties
| Compound Name | benzene;(2-carbamoylphenyl)methyl formate |
| PubChem CID | 174940813 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | benzene;(2-carbamoylphenyl)methyl formate |
| SMILES | NC(=O)c1ccccc1COC=O.c1ccccc1 |
| InChI | InChI=1S/C9H9NO3.C6H6/c10-9(12)8-4-2-1-3-7(8)5-13-6-11;1-2-4-6-5-3-1/h1-4,6H,5H2,(H2,10,12);1-6H |
| InChIKey | DXVJJRYHUJXCJC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzene;(2-carbamoylphenyl)methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;(2-carbamoylphenyl)methyl formate?
The IUPAC name of benzene;(2-carbamoylphenyl)methyl formate (CID 174940813) is benzene;(2-carbamoylphenyl)methyl formate.
What is the SMILES notation for benzene;(2-carbamoylphenyl)methyl formate?
The canonical SMILES for benzene;(2-carbamoylphenyl)methyl formate is NC(=O)c1ccccc1COC=O.c1ccccc1.
What is the InChIKey of benzene;(2-carbamoylphenyl)methyl formate?
The InChIKey is DXVJJRYHUJXCJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3.C6H6/c10-9(12)8-4-2-1-3-7(8)5-13-6-11;1-2-4-6-5-3-1/h1-4,6H,5H2,(H2,10,12);1-6H.
What are the key properties of benzene;(2-carbamoylphenyl)methyl formate?
benzene;(2-carbamoylphenyl)methyl formate has a molecular weight of 257.29 g/mol, XLogP of 2.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;(2-carbamoylphenyl)methyl formate is sourced from PubChem (CID 174940813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).