About 1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate
1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate (PubChem CID 174942063) has the molecular formula C6H7ClO5
and a molecular weight of 194.57 g/mol. Its IUPAC name is 1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate.
Molecular Properties
| Compound Name | 1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate |
| PubChem CID | 174942063 |
| Molecular Formula | C6H7ClO5 |
| Molecular Weight | 194.57 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate |
| SMILES | COC(=O)C(=O)C(C)C(=O)OCl |
| InChI | InChI=1S/C6H7ClO5/c1-3(5(9)12-7)4(8)6(10)11-2/h3H,1-2H3 |
| InChIKey | PSKCXWVBBJVKPD-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.57 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate?
The IUPAC name of 1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate (CID 174942063) is 1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate.
What is the SMILES notation for 1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate?
The canonical SMILES for 1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate is COC(=O)C(=O)C(C)C(=O)OCl.
What is the InChIKey of 1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate?
The InChIKey is PSKCXWVBBJVKPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClO5/c1-3(5(9)12-7)4(8)6(10)11-2/h3H,1-2H3.
What are the key properties of 1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate?
1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate has a molecular weight of 194.57 g/mol, XLogP of 0.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-chloro 4-O-methyl 2-methyl-3-oxobutanedioate is sourced from PubChem (CID 174942063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).