About dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate
dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate (PubChem CID 91174955) has the molecular formula C16H26O9
and a molecular weight of 362.38 g/mol. Its IUPAC name is dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate.
Molecular Properties
| Compound Name | dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate |
| PubChem CID | 91174955 |
| Molecular Formula | C16H26O9 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate |
| SMILES | C=C(C)C(=O)OC.CCC(=O)OC.COC(=O)C(=O)C(C)C(=O)OC |
| InChI | InChI=1S/C7H10O5.C5H8O2.C4H8O2/c1-4(6(9)11-2)5(8)7(10)12-3;1-4(2)5(6)7-3;1-3-4(5)6-2/h4H,1-3H3;1H2,2-3H3;3H2,1-2H3 |
| InChIKey | SXSHDGISZOQKDB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate?
The IUPAC name of dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate (CID 91174955) is dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate.
What is the SMILES notation for dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate?
The canonical SMILES for dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate is C=C(C)C(=O)OC.CCC(=O)OC.COC(=O)C(=O)C(C)C(=O)OC.
What is the InChIKey of dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate?
The InChIKey is SXSHDGISZOQKDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O5.C5H8O2.C4H8O2/c1-4(6(9)11-2)5(8)7(10)12-3;1-4(2)5(6)7-3;1-3-4(5)6-2/h4H,1-3H3;1H2,2-3H3;3H2,1-2H3.
What are the key properties of dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate?
dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate has a molecular weight of 362.38 g/mol, XLogP of 0.84, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-methyl-3-oxobutanedioate;methyl 2-methylprop-2-enoate;methyl propanoate is sourced from PubChem (CID 91174955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).