C17H23FO — CID 174943693
1-[(3E)-5-ethyl-1-fluoro-4-methylhepta-1,3-dien-3-yl]-4-methoxybenzene (PubChem CID 174943693) has the molecular formula C17H23FO and a molecular weight of 262.37 g/mol. Its IUPAC name is 1-[(3E)-5-ethyl-1-fluoro-4-methylhepta-1,3-dien-3-yl]-4-methoxybenzene.
| Compound Name | 1-[(3E)-5-ethyl-1-fluoro-4-methylhepta-1,3-dien-3-yl]-4-methoxybenzene |
|---|---|
| PubChem CID | 174943693 |
| Molecular Formula | C17H23FO |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-[(3E)-5-ethyl-1-fluoro-4-methylhepta-1,3-dien-3-yl]-4-methoxybenzene |
| SMILES | CCC(CC)/C(C)=C(\C=CF)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H23FO/c1-5-14(6-2)13(3)17(11-12-18)15-7-9-16(19-4)10-8-15/h7-12,14H,5-6H2,1-4H3/b12-11?,17-13+ |
| InChIKey | YMPUKVFCWBRMDX-DQOPQNHCSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|