C9HClF6N2O — CID 174943784
5-cyano-2,6-bis(trifluoromethyl)pyridine-3-carbonyl chloride (PubChem CID 174943784) has the molecular formula C9HClF6N2O and a molecular weight of 302.56 g/mol. Its IUPAC name is 5-cyano-2,6-bis(trifluoromethyl)pyridine-3-carbonyl chloride.
| Compound Name | 5-cyano-2,6-bis(trifluoromethyl)pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 174943784 |
| Molecular Formula | C9HClF6N2O |
| Molecular Weight | 302.56 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 5-cyano-2,6-bis(trifluoromethyl)pyridine-3-carbonyl chloride |
| SMILES | N#Cc1cc(C(=O)Cl)c(C(F)(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C9HClF6N2O/c10-7(19)4-1-3(2-17)5(8(11,12)13)18-6(4)9(14,15)16/h1H |
| InChIKey | ZBIITOGBTRAGLK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|