C15H24N2O2 — CID 174944396
4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;hexan-1-amine (PubChem CID 174944396) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;hexan-1-amine.
| Compound Name | 4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;hexan-1-amine |
|---|---|
| PubChem CID | 174944396 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;hexan-1-amine |
| SMILES | CCCCCCN.O=C1NC(=O)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C9H9NO2.C6H15N/c11-8-6-4-1-2-5(3-4)7(6)9(12)10-8;1-2-3-4-5-6-7/h1-2,4-7H,3H2,(H,10,11,12);2-7H2,1H3 |
| InChIKey | ZUNONPMWXWPJNO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|