C12H17NO8 — CID 174946865
2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid (PubChem CID 174946865) has the molecular formula C12H17NO8 and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid.
| Compound Name | 2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid |
|---|---|
| PubChem CID | 174946865 |
| Molecular Formula | C12H17NO8 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)C1(C(CC(=O)O)C(=O)O)CCCN1 |
| InChI | InChI=1S/C12H17NO8/c14-8(15)4-6(10(18)19)12(2-1-3-13-12)7(11(20)21)5-9(16)17/h6-7,13H,1-5H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | YVQDENNHVCCHRK-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |