2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid

C12H17NO8 — CID 174946865

IUPAC2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid
SMILESO=C(O)CC(C(=O)O)C1(C(CC(=O)O)C(=O)O)CCCN1
InChIInChI=1S/C12H17NO8/c14-8(15)4-6(10(18)19)12(2-1-3-13-12)7(11(20)21)5-9(16)17/h6-7,13H,1-5H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21)
InChIKeyYVQDENNHVCCHRK-UHFFFAOYSA-N
MW303.27 g/mol
LogP-0.54
Rot. Bonds8

About 2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid

2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid (PubChem CID 174946865) has the molecular formula C12H17NO8 and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid.

Molecular Properties

Compound Name2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid
PubChem CID174946865
Molecular FormulaC12H17NO8
Molecular Weight303.27 g/mol
Exact Mass303.10
IUPAC Name2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid
SMILESO=C(O)CC(C(=O)O)C1(C(CC(=O)O)C(=O)O)CCCN1
InChIInChI=1S/C12H17NO8/c14-8(15)4-6(10(18)19)12(2-1-3-13-12)7(11(20)21)5-9(16)17/h6-7,13H,1-5H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21)
InChIKeyYVQDENNHVCCHRK-UHFFFAOYSA-N
XLogP-0.54
TPSA161.23 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.27
LogP ≤ 5-0.54
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze 2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid?
The IUPAC name of 2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid (CID 174946865) is 2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid.
What is the SMILES notation for 2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid?
The canonical SMILES for 2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid is O=C(O)CC(C(=O)O)C1(C(CC(=O)O)C(=O)O)CCCN1.
What is the InChIKey of 2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid?
The InChIKey is YVQDENNHVCCHRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO8/c14-8(15)4-6(10(18)19)12(2-1-3-13-12)7(11(20)21)5-9(16)17/h6-7,13H,1-5H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21).
What are the key properties of 2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid?
2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid has a molecular weight of 303.27 g/mol, XLogP of -0.54, 8 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,2-dicarboxyethyl)pyrrolidin-2-yl]butanedioic acid is sourced from PubChem (CID 174946865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).