C10H18N2O4Pt — CID 174369189
2-(1,2-diaminocyclohexyl)butanedioic acid;platinum (PubChem CID 174369189) has the molecular formula C10H18N2O4Pt and a molecular weight of 425.34 g/mol. Its IUPAC name is 2-(1,2-diaminocyclohexyl)butanedioic acid;platinum.
| Compound Name | 2-(1,2-diaminocyclohexyl)butanedioic acid;platinum |
|---|---|
| PubChem CID | 174369189 |
| Molecular Formula | C10H18N2O4Pt |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 2-(1,2-diaminocyclohexyl)butanedioic acid;platinum |
| SMILES | NC1CCCCC1(N)C(CC(=O)O)C(=O)O.[Pt] |
| InChI | InChI=1S/C10H18N2O4.Pt/c11-7-3-1-2-4-10(7,12)6(9(15)16)5-8(13)14;/h6-7H,1-5,11-12H2,(H,13,14)(H,15,16); |
| InChIKey | WCPHXDCGMRYNRI-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |