C12H20N2O7 — CID 77334019
2-[2-(1,2-diaminocyclohexyl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 77334019) has the molecular formula C12H20N2O7 and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-[2-(1,2-diaminocyclohexyl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-(1,2-diaminocyclohexyl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 77334019 |
| Molecular Formula | C12H20N2O7 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-[2-(1,2-diaminocyclohexyl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | NC1CCCCC1(N)OC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H20N2O7/c13-7-3-1-2-4-12(7,14)21-9(17)6-11(20,10(18)19)5-8(15)16/h7,20H,1-6,13-14H2,(H,15,16)(H,18,19) |
| InChIKey | KTYPZYIMSLFOCB-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 173.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|