C7H18N4O — CID 174949060
N'-[2-[(3-methyloxaziridin-3-yl)methylamino]ethyl]ethane-1,2-diamine (PubChem CID 174949060) has the molecular formula C7H18N4O and a molecular weight of 174.25 g/mol. Its IUPAC name is N'-[2-[(3-methyloxaziridin-3-yl)methylamino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[(3-methyloxaziridin-3-yl)methylamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 174949060 |
| Molecular Formula | C7H18N4O |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.15 |
| IUPAC Name | N'-[2-[(3-methyloxaziridin-3-yl)methylamino]ethyl]ethane-1,2-diamine |
| SMILES | CC1(CNCCNCCN)NO1 |
| InChI | InChI=1S/C7H18N4O/c1-7(11-12-7)6-10-5-4-9-3-2-8/h9-11H,2-6,8H2,1H3 |
| InChIKey | ZZBHBZBXPYJZLE-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|