hafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid

C6H5HfNO4 — CID 174951888

IUPAChafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid
SMILESO=C(O)c1cc(O)[nH]c(=O)c1.[Hf]
InChIInChI=1S/C6H5NO4.Hf/c8-4-1-3(6(10)11)2-5(9)7-4;/h1-2H,(H,10,11)(H2,7,8,9);
InChIKeyAYUIYDVMPRUSAG-UHFFFAOYSA-N
MW333.60 g/mol
LogP-0.22
Rot. Bonds1

About hafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid

hafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid (PubChem CID 174951888) has the molecular formula C6H5HfNO4 and a molecular weight of 333.60 g/mol. Its IUPAC name is hafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid.

Molecular Properties

Compound Namehafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid
PubChem CID174951888
Molecular FormulaC6H5HfNO4
Molecular Weight333.60 g/mol
Exact Mass334.97
IUPAC Namehafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid
SMILESO=C(O)c1cc(O)[nH]c(=O)c1.[Hf]
InChIInChI=1S/C6H5NO4.Hf/c8-4-1-3(6(10)11)2-5(9)7-4;/h1-2H,(H,10,11)(H2,7,8,9);
InChIKeyAYUIYDVMPRUSAG-UHFFFAOYSA-N
XLogP-0.22
TPSA90.39 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.60
LogP ≤ 5-0.22
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze hafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid?
The IUPAC name of hafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid (CID 174951888) is hafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid.
What is the SMILES notation for hafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid?
The canonical SMILES for hafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid is O=C(O)c1cc(O)[nH]c(=O)c1.[Hf].
What is the InChIKey of hafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid?
The InChIKey is AYUIYDVMPRUSAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO4.Hf/c8-4-1-3(6(10)11)2-5(9)7-4;/h1-2H,(H,10,11)(H2,7,8,9);.
What are the key properties of hafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid?
hafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid has a molecular weight of 333.60 g/mol, XLogP of -0.22, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hafnium;2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid is sourced from PubChem (CID 174951888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).