C12H15N3O4 — CID 174952249
[6-[(3S)-3-hydroxypiperidine-1-carbonyl]-3-pyridinyl] carbamate (PubChem CID 174952249) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is [6-[(3S)-3-hydroxypiperidine-1-carbonyl]-3-pyridinyl] carbamate.
| Compound Name | [6-[(3S)-3-hydroxypiperidine-1-carbonyl]-3-pyridinyl] carbamate |
|---|---|
| PubChem CID | 174952249 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | [6-[(3S)-3-hydroxypiperidine-1-carbonyl]-3-pyridinyl] carbamate |
| SMILES | NC(=O)Oc1ccc(C(=O)N2CCC[C@H](O)C2)nc1 |
| InChI | InChI=1S/C12H15N3O4/c13-12(18)19-9-3-4-10(14-6-9)11(17)15-5-1-2-8(16)7-15/h3-4,6,8,16H,1-2,5,7H2,(H2,13,18)/t8-/m0/s1 |
| InChIKey | MWBSAVHWIDXAFQ-QMMMGPOBSA-N |
| XLogP | 0.14 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |