C10H15N2O4P — CID 174953315
[amino(phenylmethoxy)phosphoryl] (2S)-2-aminopropanoate (PubChem CID 174953315) has the molecular formula C10H15N2O4P and a molecular weight of 258.21 g/mol. Its IUPAC name is [amino(phenylmethoxy)phosphoryl] (2S)-2-aminopropanoate.
| Compound Name | [amino(phenylmethoxy)phosphoryl] (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 174953315 |
| Molecular Formula | C10H15N2O4P |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | [amino(phenylmethoxy)phosphoryl] (2S)-2-aminopropanoate |
| SMILES | C[C@H](N)C(=O)OP(N)(=O)OCc1ccccc1 |
| InChI | InChI=1S/C10H15N2O4P/c1-8(11)10(13)16-17(12,14)15-7-9-5-3-2-4-6-9/h2-6,8H,7,11H2,1H3,(H2,12,14)/t8-,17?/m0/s1 |
| InChIKey | QVGABIVFPQIWHN-CLBCNEFWSA-N |
| XLogP | 1.16 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|