C12H16NO5P — CID 88633321
(E)-2-amino-4-[hydroxy(phenylmethoxy)phosphoryl]pent-3-enoic acid (PubChem CID 88633321) has the molecular formula C12H16NO5P and a molecular weight of 285.24 g/mol. Its IUPAC name is (E)-2-amino-4-[hydroxy(phenylmethoxy)phosphoryl]pent-3-enoic acid.
| Compound Name | (E)-2-amino-4-[hydroxy(phenylmethoxy)phosphoryl]pent-3-enoic acid |
|---|---|
| PubChem CID | 88633321 |
| Molecular Formula | C12H16NO5P |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (E)-2-amino-4-[hydroxy(phenylmethoxy)phosphoryl]pent-3-enoic acid |
| SMILES | C/C(=C\C(N)C(=O)O)P(=O)(O)OCc1ccccc1 |
| InChI | InChI=1S/C12H16NO5P/c1-9(7-11(13)12(14)15)19(16,17)18-8-10-5-3-2-4-6-10/h2-7,11H,8,13H2,1H3,(H,14,15)(H,16,17)/b9-7+ |
| InChIKey | VQHNZBQASMTQBE-VQHVLOKHSA-N |
| XLogP | 1.70 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|